CAS 51363-01-0

4-(2-Pyridinyloxy)benzoyl chloride

Description:

4-(2-Pyridinyloxy)benzoyl chloride, with the CAS number 51363-01-0, is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and a pyridinyloxy substituent. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic acyl substitution reactions. The pyridinyloxy group contributes to its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The compound is generally soluble in organic solvents such as dichloromethane and ether, but may have limited solubility in water. Safety precautions are necessary when handling this substance, as it can be corrosive and may cause irritation to the skin and eyes. Its unique structure allows for various chemical modifications, making it a valuable building block in organic synthesis and materials science.

Formula: C₁₂H₈ClNO₂

InChI: InChI=1S/C12H8ClNO2/c13-12(15)9-4-6-10(7-5-9)16-11-3-1-2-8-14-11/h1-8H

InChI key: InChIKey=RUXGFQOJMJJPND-UHFFFAOYSA-N

SMILES: O(C1=CC=C(C(Cl)=O)C=C1)C2=CC=CC=N2

Synonyms:

• 4-(2-Pyridinyloxy)benzoyl chloride
• 4-(Pyrid-2-Yloxy)Benzoyl Chloride
• Benzoyl chloride, 4-(2-pyridinyloxy)-

4-(Pyridin-2-yloxy)benzoyl chloride

CAS: 51363-01-0

4-(Pyridin-2-yloxy)benzoyl chloride

Purity: 95%

Molecular weight: 233.65g/mol

Ref: 54-OR9644