CAS 514-07-8
:Taraxerone
Description:
Taraxerone is a triterpenoid compound primarily found in various plant species, particularly in the genus Taraxacum, which includes dandelions. It is characterized by its complex molecular structure, which consists of a tetracyclic framework typical of many triterpenes. Taraxerone is known for its potential biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in both pharmacological and nutritional research. The compound is typically a colorless to pale yellow liquid with a characteristic odor. Its solubility varies, being more soluble in organic solvents than in water. Taraxerone has been studied for its potential applications in traditional medicine and as a natural product in the food and cosmetic industries. Additionally, its presence in essential oils contributes to the aroma and flavor profiles of certain plants. As with many natural compounds, further research is ongoing to fully elucidate its mechanisms of action and potential therapeutic benefits.
Formula:C30H48O
InChI:InChI=1S/C30H48O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-23H,10-19H2,1-8H3/t20-,22+,23+,27-,28-,29-,30+/m0/s1
InChI key:InChIKey=DBCAVZSSFGIHQZ-YLAYQGCQSA-N
SMILES:C[C@]12C=3[C@](C)([C@]4([C@@](C)(CC3)CCC(C)(C)C4)[H])CC[C@@]1([C@]5(C)[C@@](CC2)(C(C)(C)C(=O)CC5)[H])[H]
Synonyms:- Skimmione
- 27-Norolean-14-en-3-one, 13-methyl-, (13α)-
- D-Friedoolean-14-en-3-one
- Taraxerone
- (13α)-13-Methyl-27-norolean-14-en-3-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(4aS,6aS,6aR,8aR,12aS,14aS,14bS)-4,4,6a,6a,8a,11,11,14b-octamethyl-2,4 a,5,6,8,9,10,12,12a,13,14,14a-dodecahydro-1H-picen-3-one
CAS:Formula:C30H48OPurity:%Color and Shape:SolidMolecular weight:424.7015Taraxerone
CAS:Formula:C30H48OPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:424.71Taraxerone
CAS:Taraxerone exhibits allelopathic, antifungal properties; it stabilizes catalase, SOD, and counters ethanol-induced glutathione reduction.
Formula:C30H48OPurity:98%Color and Shape:SolidMolecular weight:424.7Taraxerone
CAS:Controlled ProductTaraxerone is a naturally occurring triterpenoid, which is extracted primarily from plants like Taraxacum officinale (commonly known as dandelion). It functions through a variety of biochemical mechanisms, including modulation of inflammatory pathways and antioxidant activity. These activities are attributed to its ability to interact with various cellular receptors and signaling molecules.Formula:C30H48OPurity:Min. 95%Color and Shape:White PowderMolecular weight:424.7 g/mol






