CAS 514-92-1
:Torularhodin
Description:
Torularhodin is a carotenoid pigment primarily produced by certain fungi, particularly the yeast species Rhodotorula. It is characterized by its reddish-orange color, which is attributed to its conjugated double bond system, a common feature in carotenoids that contributes to their light-absorbing properties. This pigment is soluble in organic solvents and exhibits antioxidant properties, making it of interest in various applications, including food coloring and potential health benefits. Torularhodin is known for its stability under various conditions, although it can be sensitive to extreme light and heat. Its chemical structure includes multiple isoprenoid units, which are typical of carotenoids, and it plays a role in the photosynthetic processes of certain microorganisms. Additionally, research has indicated that torularhodin may have potential applications in cosmetics and pharmaceuticals due to its bioactive properties. Overall, torularhodin is a notable compound in both microbiology and biochemistry, reflecting the diverse roles of pigments in nature.
Formula:C40H52O2
InChI:InChI=1/C40H52O2/c1-31(19-12-21-33(3)22-13-23-34(4)25-15-26-37(7)39(41)42)17-10-11-18-32(2)20-14-24-35(5)28-29-38-36(6)27-16-30-40(38,8)9/h10-15,17-26,28-29H,16,27,30H2,1-9H3,(H,41,42)/b11-10+,19-12+,20-14+,22-13+,25-15+,29-28+,31-17+,32-18+,33-21+,34-23+,35-24+,37-26+
InChI key:InChIKey=NESPPCWGYRQEJQ-VATUXEBJSA-N
SMILES:C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/C=C/C=C(/C(O)=O)\C)\C)\C)\C)/C)/C)\C=1C(C)(C)CCCC1C
Synonyms:- (3'E)-3',4'-didehydro-beta,psi-caroten-16'-oic acid
- 3′,4′-Didehydro-β,ψ-caroten-16′-oic acid
- Torularhodin, all-trans-
- Torularodine
- all-trans-Torularhodin
- β,ψ-Caroten-16′-oic acid, 3′,4′-didehydro-
- γ-Caroten-16′-oic acid, 3′,4′-didehydro-
- γ-Caroten-16′-oic acid, 3′,4′-didehydro-, all-trans-
- Torularhodin
- Einecs 208-189-3
- 3',4'-Didehydro-β,ψ-caroten-16'-oic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Torularhodin
CAS:Torularhodin is a natural carotenoid that has been shown to be an inducer of apoptosis. It has pro-apoptotic properties and induces cell death in cancer cells by altering the mitochondrial membrane potential, leading to inhibition of mitochondrial respiration, ATP production, and reactive oxygen species (ROS) production. Torularhodin also inhibits polyene antibiotics such as erythromycin and tetracycline. Torularhodin binds to the bacterial cell surface without entering the cell, causing damage to the cellular membrane by irreversibly reacting with lipids. This causes a loss of cytoplasmic proteins and leakage of intracellular contents from the cell, leading to lysis of the bacteria. Torularhodin also binds to DNA polymerase, inhibiting its activity.Formula:C40H52O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:564.84 g/mol
