
CAS 514-99-8
:Myrtanol
Description:
Myrtanol, with the CAS number 514-99-8, is a chemical compound classified as a monoterpene alcohol. It is derived from the essential oils of various plants, particularly those in the Myrtaceae family, such as myrtle and eucalyptus. Myrtanol is characterized by its pleasant, aromatic scent, which makes it valuable in the fragrance and flavoring industries. The compound is typically colorless to pale yellow and is known for its solubility in organic solvents, while being less soluble in water. Myrtanol exhibits various biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in pharmaceutical applications. Additionally, it is used in the formulation of cosmetics and personal care products due to its skin-friendly attributes. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards, particularly regarding skin and respiratory exposure. Overall, Myrtanol is a versatile compound with applications spanning multiple industries, primarily due to its aromatic qualities and biological activity.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h7-9,11H,3-6H2,1-2H3
InChI key:InChIKey=LDWAIHWGMRVEFR-UHFFFAOYSA-N
SMILES:CC1(C)C2C(CO)CCC1C2
Synonyms:- Dihydromyrtenol
- Myrtanol
- 10-Pinanol
- 6,6-Dimethylbicyclo[3.1.1]heptane-2-methanol
- Bicyclo[3.1.1]heptane-2-methanol, 6,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.