
CAS 5140-35-2
:9-Hydroxy-1,2,10-trimethoxy-7H-dibenzo[de,g]quinolin-7-one
Description:
9-Hydroxy-1,2,10-trimethoxy-7H-dibenzo[de,g]quinolin-7-one, with CAS number 5140-35-2, is a complex organic compound characterized by its unique dibenzoquinoline structure. This substance features multiple methoxy groups, which contribute to its solubility and reactivity. The presence of the hydroxyl group enhances its potential for hydrogen bonding, influencing its physical and chemical properties. Typically, compounds of this nature exhibit interesting biological activities, including potential antioxidant and antimicrobial properties, making them of interest in medicinal chemistry. The molecular structure suggests that it may interact with various biological targets, potentially leading to therapeutic applications. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 9-Hydroxy-1,2,10-trimethoxy-7H-dibenzo[de,g]quinolin-7-one represents a fascinating area of study within organic and medicinal chemistry, with implications for drug development and biological research.
Formula:C19H15NO5
InChI:InChI=1S/C19H15NO5/c1-23-13-8-10-11(7-12(13)21)18(22)17-15-9(4-5-20-17)6-14(24-2)19(25-3)16(10)15/h4-8,21H,1-3H3
InChI key:InChIKey=VITQCDLNBVTCJS-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C3C(C(=O)C=4C2=CC(OC)=C(O)C4)=NC=CC3=CC1OC
Synonyms:- 9-Hydroxy-1,2,10-trimethoxy-7H-dibenzo[de,g]quinolin-7-one
- 7H-Dibenzo[de,g]quinolin-7-one, 9-hydroxy-1,2,10-trimethoxy-
- Atheroline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Atheroline
CAS:Atheroline is a constituent of Lindera glauca.
Formula:C19H15NO5Color and Shape:SolidMolecular weight:337.33
