CAS 51412-23-8

(1-phenyl-1H-pyrazol-4-yl)acetonitrile

Description:

(1-phenyl-1H-pyrazol-4-yl)acetonitrile, with the CAS number 51412-23-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group attached to the pyrazole, contributing to its aromatic properties and potential reactivity. The acetonitrile functional group (-C≡N) introduces a nitrile moiety, which is known for its polar character and ability to participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. The presence of both the pyrazole and nitrile functionalities suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit interesting biological activities due to the structural diversity provided by the pyrazole and phenyl groups. Its solubility, stability, and reactivity can vary based on the solvent and conditions, making it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₉N₃

InChI: InChI=1/C11H9N3/c12-7-6-10-8-13-14(9-10)11-4-2-1-3-5-11/h1-5,8-9H,6H2

SMILES: c1ccc(cc1)n1cc(CC#N)cn1

2-(1-Phenyl-1H-pyrazol-4-yl)acetonitrile

CAS: 51412-23-8

2-(1-Phenyl-1H-pyrazol-4-yl)acetonitrile is a chemical compound that belongs to the group of methylamines. It can be found in bacteria, where it has been shown to react with methylamine to form tautomers. 2-(1-Phenyl-1H-pyrazol-4-yl)acetonitrile has biological activity and can be detected by the spectra of its compounds. The biological activity may be due to its ability to cyclize into a pyrazole ring or react with other chemicals.

Formula: C₁₁H₉N₃

Purity: Min. 95%

Molecular weight: 183.21 g/mol

Ref: 3D-BCA41223