CAS 51414-25-6

3-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde

Description:

3-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde, identified by its CAS number 51414-25-6, is an organic compound characterized by its unique structure, which includes a cyclohexene ring and an aldehyde functional group. This compound features a hydroxyl group and a branched alkyl chain, contributing to its potential solubility in organic solvents and its reactivity in various chemical reactions. The presence of the aldehyde group suggests that it can participate in oxidation and condensation reactions, making it useful in organic synthesis. Additionally, the hydroxyl group may impart some degree of polarity, influencing its interactions with other molecules. This compound may also exhibit specific biological activities, although detailed studies would be necessary to elucidate its potential applications in fields such as fragrance chemistry or pharmaceuticals. Overall, its structural characteristics suggest versatility in chemical reactivity and potential utility in various applications.

Formula: C₁₃H₂₂O₂

InChI: InChI=1S/C13H22O2/c1-13(2,15)8-4-7-11-5-3-6-12(9-11)10-14/h5,10,12,15H,3-4,6-9H2,1-2H3

InChI key: InChIKey=OLXLPKQCGWYRFQ-UHFFFAOYSA-N

SMILES: C(CCC(C)(C)O)C=1CC(C=O)CCC1

Synonyms:

• 3-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde
• 3-Cyclohexene-1-carboxaldehyde, 3-(4-hydroxy-4-methylpentyl)-
• 4-(4-Hydroxy-4-Methylpentyl)-3-Cyclohexene-1-Carboxaldehyde

Liral Impurity 1

CAS: 51414-25-6

Formula: C₁₃H₂₂O₂

Molecular weight: 210.32

Ref: 4Z-L-231002