CAS 51419-48-8

5,7-dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4H-chromen-4-one

Description:

5,7-Dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4H-chromen-4-one, with the CAS number 51419-48-8, is a complex organic compound characterized by its polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a chromone backbone, along with a benzodioxin moiety, suggests that it may exhibit various biological activities, including anti-inflammatory and anticancer effects. Its solubility and stability can be influenced by the hydroxyl and methoxy substituents, which may enhance its interaction with biological targets. Additionally, the compound's intricate structure may allow for specific binding interactions, making it of interest in medicinal chemistry and pharmacology. Research into its properties and potential applications is ongoing, particularly in the context of natural product chemistry and the development of therapeutic agents. Overall, this compound exemplifies the diverse functionalities that can arise from complex organic molecules in the realm of chemical and biological sciences.

Formula: C₂₅H₂₀O₉

InChI: InChI=1/C25H20O9/c1-31-20-7-13(2-4-15(20)28)25-23(11-26)33-21-6-12(3-5-18(21)34-25)19-10-17(30)24-16(29)8-14(27)9-22(24)32-19/h2-10,23,25-29H,11H2,1H3

SMILES: COc1cc(ccc1O)C1C(CO)Oc2cc(ccc2O1)c1cc(=O)c2c(cc(cc2o1)O)O

Synonyms:

• Hydnocarpin

(Rac)-Hydnocarpin

CAS: 51419-48-8

Formula: C₂₅H₂₀O₉

Purity: 97.0%

Molecular weight: 464.4209

Ref: IN-DA00DJZM

Hydnocarpin

CAS: 51419-48-8

Formula: C₂₅H₂₀O₉

Molecular weight: 464.43

Ref: 7W-GY2361

Hydnocarpin

CAS: 51419-48-8

Formula: C₂₅H₂₀O₉

Purity: 95%~99%

Molecular weight: 464.426

Ref: BP-BP4411

(rac)-Hydnocarpin

CAS: 51419-48-8

(rac)-Hydnocarpin is a natural phytochemical compound that belongs to the class of flavonoid lactones. It is primarily derived from the seeds of the Hydnocarpus genus, which are known for their medicinal properties. The mode of action of (rac)-Hydnocarpin involves the modulation of inflammatory pathways and inhibition of microbial growth. This compound interacts with specific enzymes and receptors, leading to reduced inflammation and exerting antimicrobial effects against certain pathogens.

Formula: C₂₅H₂₀O₉

Purity: Min. 95%

Molecular weight: 464.4 g/mol

Ref: 3D-BCA41948

(Rac)-Hydnocarpin

CAS: 51419-48-8

Hydnocarpin is a flavonoid isolated and purified from the seeds of Hydnocarpus wightiana Blume., and exhibits moderate cytotoxic on cancer cells

Formula: C₂₅H₂₀O₉

Purity: 98%

Color and Shape: Solid

Molecular weight: 464.426

Ref: TM-TN2334