CAS 51419-48-8
:5,7-dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4H-chromen-4-one
Description:
5,7-Dihydroxy-2-[2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4H-chromen-4-one, with the CAS number 51419-48-8, is a complex organic compound characterized by its polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of a chromone backbone, along with a benzodioxin moiety, suggests that it may exhibit various biological activities, including anti-inflammatory and anticancer effects. Its solubility and stability can be influenced by the hydroxyl and methoxy substituents, which may enhance its interaction with biological targets. Additionally, the compound's intricate structure may allow for specific binding interactions, making it of interest in medicinal chemistry and pharmacology. Research into its properties and potential applications is ongoing, particularly in the context of natural product chemistry and the development of therapeutic agents. Overall, this compound exemplifies the diverse functionalities that can arise from complex organic molecules in the realm of chemical and biological sciences.
Formula:C25H20O9
InChI:InChI=1/C25H20O9/c1-31-20-7-13(2-4-15(20)28)25-23(11-26)33-21-6-12(3-5-18(21)34-25)19-10-17(30)24-16(29)8-14(27)9-22(24)32-19/h2-10,23,25-29H,11H2,1H3
SMILES:COc1cc(ccc1O)C1C(CO)Oc2cc(ccc2O1)c1cc(=O)c2c(cc(cc2o1)O)O
Synonyms:- Hydnocarpin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(Rac)-Hydnocarpin
CAS:(Rac)-Hydnocarpin, a flavonolignan from Pueraria lobata, induces apoptosis in ovarian cancer cells via ROS-caspase signaling and reprograms tumor-associated immune cells.Formula:C25H20O9Purity:99.31%Color and Shape:SolidMolecular weight:464.43(rac)-Hydnocarpin
CAS:(rac)-Hydnocarpin is a natural phytochemical compound that belongs to the class of flavonoid lactones. It is primarily derived from the seeds of the Hydnocarpus genus, which are known for their medicinal properties. The mode of action of (rac)-Hydnocarpin involves the modulation of inflammatory pathways and inhibition of microbial growth. This compound interacts with specific enzymes and receptors, leading to reduced inflammation and exerting antimicrobial effects against certain pathogens.
Formula:C25H20O9Purity:Min. 95%Molecular weight:464.4 g/mol




