CAS 51421-33-1

(2-Naphthalenylmethyl)hydrazine

Description:

(2-Naphthalenylmethyl)hydrazine, with the CAS number 51421-33-1, is an organic compound characterized by the presence of a hydrazine functional group attached to a naphthalene moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The hydrazine group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, (2-Naphthalenylmethyl)hydrazine may exhibit biological activity, making it of interest in medicinal chemistry. However, like many hydrazine derivatives, it may pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. Overall, this compound serves as a valuable building block in synthetic organic chemistry.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c12-13-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,13H,8,12H2

InChI key: InChIKey=VWAKMCBHVWHZAL-UHFFFAOYSA-N

SMILES: C(NN)C1=CC2=C(C=C1)C=CC=C2

Synonyms:

• (2-Naphthalenylmethyl)hydrazine
• β-Hydrazinomethylnaphthalene
• Hydrazine, (2-naphthalenylmethyl)-
• 1-(Naphthalen-2-ylmethyl)hydrazine