CAS 51422-01-6: 4-Chloro-6-fluoropyrimidine

Description:4-Chloro-6-fluoropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of chlorine at the 4-position and fluorine at the 6-position contributes to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its molecular structure allows for diverse chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in medicinal chemistry. Additionally, 4-chloro-6-fluoropyrimidine exhibits moderate solubility in polar organic solvents, which facilitates its use in various chemical processes. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is significant in the field of organic synthesis and drug development due to its functional groups and reactivity.

Formula:C₄H₂ClFN₂

InChI:InChI=1S/C4H2ClFN2/c5-3-1-4(6)8-2-7-3/h1-2H

InChI key:InChIKey=DLAFWIYXXOBITQ-UHFFFAOYSA-N

SMILES:FC1=NC=NC(Cl)=C1

Synonyms:
4-Chloro-6-fluoro-pyrimidine
Pyrimidine, 4-chloro-6-fluoro-
4-Chloro-6-fluoropyrimidine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Pyrimidine, 4-chloro-6-fluoro- (9CI) REF: IN-DA00DG5DCAS: 51422-01-6	95%	92.00 €~610.00 €	Mon 14 Apr 25
4-Chloro-6-fluoropyrimidine REF: 54-PC5358CAS: 51422-01-6	By gc: 99.8% by area (Typical Value in Batch COA)	143.00 €~400.00 €	Tue 15 Apr 25
4-Chloro-6-Fluoro-Pyrimidine REF: 3D-FC78844CAS: 51422-01-6	Min. 95%	To inquire	Tue 27 May 25
4-Chloro-6-fluoropyrimidine REF: 10-F774298CAS: 51422-01-6	98%	- - -	Discontinued product