CAS 51422-74-3
:(1S,2S)-1-bromo-2-fluorocyclohexane
Description:
(1S,2S)-1-bromo-2-fluorocyclohexane is a chiral organic compound characterized by the presence of both bromine and fluorine substituents on a cyclohexane ring. The specific stereochemistry indicated by the (1S,2S) notation suggests that the bromine and fluorine atoms are positioned in a specific three-dimensional arrangement, which can influence the compound's reactivity and interactions with other molecules. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits moderate volatility. Its molecular structure contributes to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The presence of halogens in the structure often enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's chirality may lead to different biological activities depending on the enantiomer, which is an important consideration in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C6H10BrF
InChI:InChI=1/C6H10BrF/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6-/m0/s1
SMILES:C1CC[C@@H]([C@H](C1)Br)F
Synonyms:- Cyclohexane, 1-bromo-2-fluoro-, trans-
- trans-1-Bromo-2-Fluorocyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.