CAS 5143-72-6

DL-Alanine, N-acetyl-, ethyl ester

Description:

DL-Alanine, N-acetyl-, ethyl ester, with the CAS number 5143-72-6, is an organic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of an acetyl group and an ethyl ester functional group attached to the alanine backbone. This compound is typically a white to off-white crystalline solid, soluble in organic solvents such as ethanol and methanol, but less soluble in water. Its molecular structure includes both hydrophilic and hydrophobic regions, which can influence its behavior in biological systems. DL-Alanine itself is a non-essential amino acid that plays a role in protein synthesis and metabolism. The N-acetylation and ethyl esterification enhance its stability and may affect its bioavailability and pharmacokinetic properties. This compound is often used in biochemical research, pharmaceuticals, and as a building block in organic synthesis. Safety data should be consulted for handling and potential hazards, as with any chemical substance.

Formula: C₇H₁₃NO₃

InChI: InChI=1S/C7H13NO3/c1-4-11-7(10)5(2)8-6(3)9/h5H,4H2,1-3H3,(H,8,9)

InChI key: BFNYDDPQMKYKKJ-UHFFFAOYSA-N

SMILES: CCOC(=O)C(C)NC(=O)C