CymitQuimica logo

CAS 51444-52-1

:

N,N-diethyl-2-[(4-{[2-(octyloxy)benzoyl]amino}benzoyl)oxy]ethanaminium chloride

Description:
N,N-Diethyl-2-[(4-{[2-(octyloxy)benzoyl]amino}benzoyl)oxy]ethanaminium chloride, with CAS number 51444-52-1, is a quaternary ammonium compound characterized by its complex structure, which includes a diethylamino group and a long-chain octyloxy substituent. This compound typically exhibits amphiphilic properties due to the presence of both hydrophilic (the quaternary ammonium and benzoyl groups) and hydrophobic (the octyloxy chain) components, making it useful in various applications such as surfactants, emulsifiers, or drug delivery systems. Its quaternary ammonium nature imparts cationic characteristics, which can enhance its interaction with negatively charged surfaces or biological membranes. The presence of multiple aromatic rings may contribute to its stability and potential photophysical properties. Additionally, the chloride ion serves as a counterion, influencing the solubility and overall behavior of the compound in different solvents. Overall, this substance's unique structural features make it a candidate for research in fields like materials science, pharmaceuticals, and nanotechnology.
Formula:C28H41ClN2O4
InChI:InChI=1/C28H40N2O4.ClH/c1-4-7-8-9-10-13-21-33-26-15-12-11-14-25(26)27(31)29-24-18-16-23(17-19-24)28(32)34-22-20-30(5-2)6-3;/h11-12,14-19H,4-10,13,20-22H2,1-3H3,(H,29,31);1H
SMILES:CCCCCCCCOc1ccccc1C(=O)Nc1ccc(cc1)C(=O)OCCN(CC)CC.Cl
Synonyms:
  • 4-[[2-(Octyloxy)benzoyl]amino]benzoic acid 2-(diethylamino)ethyl ester hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.