CAS 51446-31-2

4-Fluoro-3-hydroxybenzoic acid

Description:

4-Fluoro-3-hydroxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a hydroxyl group on a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) attached to a benzene ring that also contains a hydroxyl group (-OH) at the meta position relative to the carboxylic acid and a fluorine atom at the para position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. It exhibits acidic properties, allowing it to donate protons in solution. The presence of the fluorine atom can influence the compound's reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, its unique functional groups can lead to specific interactions in chemical reactions, contributing to its potential applications in synthesis and material science.

Formula: C₇H₄FO₃

InChI: InChI=1/C7H5FO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11)/p-1

SMILES: c1cc(c(cc1C(=O)O)[O-])F

Synonyms:

• (4-Fluorophenyl)(3-Phenyloxiran-2-Yl)Methanone
• 4-Fluoro-3-Hydroxybenzoate
• 3-Hydroxy-4-fluorobenzoic acid

4-Fluoro-3-hydroxybenzoic acid

CAS: 51446-31-2

Formula: C₇H₅FO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.1112

Ref: IN-DA003LE6

4-Fluoro-3-hydroxybenzoic acid

CAS: 51446-31-2

4-Fluoro-3-hydroxybenzoic acid

Formula: C₇H₅FO₃

Purity: 98%

Color and Shape: pale grey solid

Molecular weight: 156.11g/mol

Ref: 54-PC7701

4-Fluoro-3-hydroxybenzoic acid

CAS: 51446-31-2

4-Fluoro-3-hydroxybenzoic acid is a colorless solid that can be produced through the sulfonation of 4-fluorophenol with sulfuric acid. This process usually takes place in two steps: first, the phenol is refluxed with sulfur trioxide and then aqueous potassium hydroxide is added to the mixture. The reaction produces a sulfite salt, which is then treated with sodium sulfite to produce the desired acid. 4-Fluoro-3-hydroxybenzoic acid can also be synthesized by adding sulfur dioxide to an aqueous solution of 3% hydrogen peroxide and adding potassium hydroxide dropwise until effervescence ceases. This method produces an insoluble precipitate, which is filtered out and washed with water. The product can then be purified by recrystallization from hot water or by washing with ether.

Formula: C₇H₅FO₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 156.11 g/mol

Ref: 3D-FF71035

4-Fluoro-3-hydroxybenzoic acid

CAS: 51446-31-2

Formula: C₇H₅FO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 156.112

Ref: 10-F009206

4-Fluoro-3-hydroxybenzoic acid

CAS: 51446-31-2

Formula: C₇H₅FO₃

Purity: 98.0 min. %

Color and Shape: White to light-brown solid

Molecular weight: 156.11

Ref: 08-F235