CAS 51448-00-1

3,4,5-trichloro-6-phenylpyridazine

Description:

3,4,5-Trichloro-6-phenylpyridazine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of three chlorine atoms at the 3, 4, and 5 positions contributes to its reactivity and potential applications in various chemical processes. The phenyl group at the 6 position enhances its aromatic character and may influence its solubility and interaction with other compounds. This substance is typically used in research and development, particularly in the fields of agrochemicals and pharmaceuticals, due to its potential biological activity. Its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose environmental and health risks. Overall, 3,4,5-trichloro-6-phenylpyridazine is a notable compound in synthetic organic chemistry with specific applications driven by its structural features.

Formula: C₁₀H₅Cl₃N₂

InChI: InChI=1/C10H5Cl3N2/c11-7-8(12)10(13)15-14-9(7)6-4-2-1-3-5-6/h1-5H

SMILES: c1ccc(cc1)c1c(c(c(Cl)nn1)Cl)Cl

3,4,5-trichloro-6-phenylpyridazine

CAS: 51448-00-1

3,4,5-trichloro-6-phenylpyridazine

Purity: ≥95%

Molecular weight: 259.52g/mol

Ref: 54-OR22370