CAS 51449-86-6
:5-(2-Methylphenyl)-1H-tetrazole
Description:
5-(2-Methylphenyl)-1H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a 2-methylphenyl group attached to the tetrazole, contributing to its unique properties. It is typically a crystalline solid and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of the tetrazole moiety often imparts interesting chemical reactivity, making it a subject of interest in various fields, including pharmaceuticals and materials science. The compound may also display biological activity, which can be explored for potential applications in drug development. Its CAS number, 51449-86-6, is a unique identifier that facilitates the search for information regarding its synthesis, safety, and handling. As with many nitrogen-containing heterocycles, it may also be involved in coordination chemistry and could serve as a ligand in metal complexes.
Formula:C8H7N4
InChI:InChI=1/C8H7N4/c1-6-4-2-3-5-7(6)8-9-11-12-10-8/h2-5H,1H3/q-1
SMILES:Cc1ccccc1C1=NN=[N-]=N1
Synonyms:- 5-(o-Tolyl)-1H-tetrazole
- 5-(2-methylphenyl)-2H-tetrazole
- 5-(2-Methylphenyl)Tetrazol-1-Ide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-(2-Methylphenyl)-1H-tetrazole, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H8N4Purity:99%Molecular weight:160.185-(2-methylphenyl)-2H-tetrazole
CAS:Formula:C8H8N4Purity:95.0%Color and Shape:SolidMolecular weight:160.185-(o-Tolyl)tetrazole
CAS:<p>5-(o-Tolyl)tetrazole is a compound that can be synthesized by the reaction of tetrazole with an aldehyde. It has been shown to have high efficiency in the preparation of halides, including chlorides and bromides. 5-(o-Tolyl)tetrazole is also efficient for the synthesis of functional groups, such as methyl tetrazole, ethyl tetrazole, phenyl tetrazole, and substituted phenyl tetrazoles. The cyclic form of 5-(o-tolyl)tetrazole is obtained through irradiation or catalysis.<br>5-(o-Tolyl)tetrazole can also be used as a ligand in coordination chemistry to generate metal complexes with various metals.</p>Formula:C8H8N4Purity:Min. 95%Molecular weight:160.18 g/mol
