CymitQuimica logo

CAS 5145-53-9

:

3,3′,4′-Tri-O-methylellagic acid

Description:
3,3′,4′-Tri-O-methylellagic acid is a naturally occurring polyphenolic compound derived from ellagic acid, characterized by the presence of three methoxy groups attached to its structure. This compound is known for its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anticancer activities. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic methoxy groups. The compound is often studied in the context of its role in plant defense mechanisms and its potential therapeutic applications in human health. Additionally, 3,3′,4′-Tri-O-methylellagic acid may exhibit various biological activities, including the ability to scavenge free radicals and modulate cellular signaling pathways. Its presence in various fruits and vegetables highlights its importance in nutrition and pharmacology. As with many polyphenols, further research is ongoing to fully understand its mechanisms of action and potential applications in dietary supplements and pharmaceuticals.
Formula:C17H12O8
InChI:InChI=1S/C17H12O8/c1-21-8-4-6-10-11-7(16(19)24-14(10)12(8)18)5-9(22-2)13(23-3)15(11)25-17(6)20/h4-5,18H,1-3H3
InChI key:InChIKey=NDXSDWFOYZXARW-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C3C4=C(OC(=O)C3=CC1OC)C(O)=C(OC)C=C4C(=O)O2
Synonyms:
  • [1]Benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione, 3-hydroxy-2,7,8-trimethoxy-
  • 2,7,8-Trimethylellagic acid
  • Nasutin B
  • 3-Hydroxy-2,7,8-trimethoxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione
  • 3,3′,4′-Tri-O-methylellagic acid
Found 0 products.