CAS 51450-24-9
:Lactal Hexaacetate
Description:
Lactal Hexaacetate, with the CAS number 51450-24-9, is an organic compound that belongs to the class of acetates. It is characterized by the presence of multiple acetate groups attached to a lactal structure, which is derived from lactone chemistry. This compound typically appears as a colorless to pale yellow liquid and is known for its sweet, fruity odor. Lactal Hexaacetate is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. It is often used in the synthesis of various chemical intermediates and may serve as a flavoring agent or fragrance component in the food and cosmetic industries. Additionally, its chemical stability and reactivity can make it useful in various applications, including research and development in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C24H32O15
InChI:InChI=1/C24H32O15/c1-11(25)32-9-18-20(17(7-8-31-18)34-13(3)27)39-24-23(37-16(6)30)22(36-15(5)29)21(35-14(4)28)19(38-24)10-33-12(2)26/h7-8,17-24H,9-10H2,1-6H3/t17-,18-,19-,20+,21+,22+,23-,24+/m1/s1
Synonyms:- Hexa-O-acetyl-lactal
- 1,4-di-O-acetyl-2,6-anhydro-5-deoxy-3-O-(2,3,4,6-tetra-O-acetylhexopyranosyl)hex-5-enitol
- 3,6-di-O-acetyl-1,5-anhydro-2-deoxy-4-O-(2,3,4,6-tetra-O-acetyl-beta-D-galactopyranosyl)-D-arabino-hex-1-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Lactal Hexaacetate
CAS:Controlled Product<p>Applications Lactal Hexaacetate (cas# 51450-24-9) is a compound useful in organic synthesis.<br></p>Formula:C24H32O15Color and Shape:WhiteMolecular weight:560.503,6-Di-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-D-glucal
CAS:3,6-Di-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-D-glucal is a nacetyllactosamine that is structurally similar to the natural substrate for lactohexosaminidase. This compound inhibits the enzyme activity of this enzyme and other related enzymes. 3,6-Di-O-acetyl-4,6 D -glucal has been shown to inhibit endothelial cell growth in vitro. It also binds to the receptor on endothelial cells and blocks the signal pathways involved in cell growth. The glucose moiety of 3,6 Di O acetyl 4,6 D glucal inhibits lipases by binding to their active sites.Formula:C24H32O15Purity:Min. 95%Color and Shape:White PowderMolecular weight:560.5 g/mol


