CAS 51450-38-5
:1,5-Anhydro-2-deoxy-4,6-O-(1-methylethylidene)-D-erythro-hex-1-en-3-ulose
Description:
1,5-Anhydro-2-deoxy-4,6-O-(1-methylethylidene)-D-erythro-hex-1-en-3-ulose, with CAS number 51450-38-5, is a carbohydrate derivative characterized by its unique structural features. This compound is an anhydro sugar, indicating the absence of a water molecule that typically connects two hydroxyl groups in sugars. The presence of the 1-methylethylidene group suggests that it has a protective acetal or ketal structure, which can influence its reactivity and stability. The hex-1-en-3-ulose structure indicates that it contains a double bond and a carbonyl group, which are key functional groups that can participate in various chemical reactions, such as oxidation or reduction. This compound may exhibit specific stereochemical configurations, contributing to its biological activity and potential applications in fields like biochemistry or pharmaceuticals. Its solubility, melting point, and reactivity would depend on the surrounding conditions, such as pH and temperature, making it an interesting subject for further study in carbohydrate chemistry.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-9(2)12-5-7-8(13-9)6(10)3-4-11-7/h3-4,7-8H,5H2,1-2H3/t7-,8+/m1/s1
InChI key:InChIKey=GAFDBZPDSHSNKK-SFYZADRCSA-N
SMILES:O=C1[C@]2([C@@](COC(C)(C)O2)(OC=C1)[H])[H]
Synonyms:- 1,5-Anhydro-2-deoxy-4,6-O-(1-methylethylidene)-D-erythro-hex-1-en-3-ulose
- Hex-1-en-3-ulose, 1,5-anhydro-2-deoxy-4,6-O-(1-methylethylidene)-
- NSC 306870
- D-erythro-Hex-1-en-3-ulose, 1,5-anhydro-2-deoxy-4,6-O-(1-methylethylidene)-
- Pyrano[3,2-d]-1,3-dioxin, D-erythro-hex-1-en-3-ulose deriv.
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery