CAS 51460-47-0

thiophene-3-carboxamide

Description:

Thiophene-3-carboxamide is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carboxamide functional group (-C(=O)NH2) at the 3-position of the thiophene ring imparts specific chemical properties, including the ability to participate in hydrogen bonding due to the amide group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the polar nature of the carboxamide group. Thiophene-3-carboxamide can be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in organic synthesis and materials science. Its derivatives may exhibit biological activity, which can be explored for potential pharmaceutical applications. The compound's stability and reactivity can be influenced by substituents on the thiophene ring, making it a versatile building block in synthetic chemistry. Overall, thiophene-3-carboxamide is a valuable compound in both academic research and industrial applications.

Formula: C₅H₅NOS

InChI: InChI=1/C5H5NOS/c6-5(7)4-1-2-8-3-4/h1-3H,(H2,6,7)

SMILES: c1cscc1C(=N)O

Thiophene-3-carboxamide

CAS: 51460-47-0

Formula: C₅H₅NOS

Color and Shape: Solid

Molecular weight: 127.1643

Ref: IN-DA003USQ

Thiophene-3-carboxamide

CAS: 51460-47-0

Thiophene-3-carboxamide

Formula: C₅H₅NOS

Purity: 95

Color and Shape: white powder

Molecular weight: 127.16g/mol

Ref: 54-OR60025

Thiophene-3-carboxylic acid amide

CAS: 51460-47-0

Formula: C₅H₅NOS

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 127.16

Ref: 10-F316972

thiophene-3-carboxamide

CAS: 51460-47-0

Thiophene-3-carboxamide is an antibacterial agent that inhibits the growth of bacteria by binding to their ribosomes and inhibiting protein synthesis. It has been shown to be active against influenza virus, highlighting its potential as a drug for the treatment of influenza. Thiophene-3-carboxamide also has anti-tumor activities and can inhibit cancer cell growth by preventing DNA replication and RNA transcription. This drug binds to the viral neuraminidase, which is an enzyme that cleaves sialic acid from glycoproteins in the host cell membrane. This inhibits the release of progeny viruses from infected cells, thus reducing viral load.

Formula: C₅H₅NOS

Purity: Min. 95%

Molecular weight: 127.17 g/mol

Ref: 3D-BCA46047