
CAS 51463-16-2
:8-Fluoro-3(2H)-isoquinolinone
Description:
8-Fluoro-3(2H)-isoquinolinone is a chemical compound characterized by its isoquinolinone structure, which features a fused bicyclic system comprising a benzene ring and a pyridine-like ring. The presence of a fluorine atom at the 8-position of the isoquinolinone enhances its reactivity and influences its biological properties. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit fluorescence properties, which can be useful in various analytical applications. As with many fluorinated compounds, it may possess unique pharmacokinetic and pharmacodynamic profiles, contributing to its potential therapeutic uses. Safety and handling precautions should be observed due to the presence of fluorine and the compound's potential biological activity.
Formula:C9H6FNO
InChI:InChI=1S/C9H6FNO/c10-8-3-1-2-6-4-9(12)11-5-7(6)8/h1-5H,(H,11,12)
InChI key:InChIKey=ZMVAAIMUESJOOM-UHFFFAOYSA-N
SMILES:FC=1C=2C(=CC(=O)NC2)C=CC1
Synonyms:- 3(2H)-Isoquinolinone, 8-fluoro-
- 8-Fluoro-3(2H)-isoquinolinone
- 8-Fluoroisoquinolin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.