CymitQuimica logo

CAS 5147-74-0

:

5-amino-3-thioxo-3H-1,2-dithiole-4-carbonitrile

Description:
5-Amino-3-thioxo-3H-1,2-dithiole-4-carbonitrile, with the CAS number 5147-74-0, is a heterocyclic compound characterized by its unique structure that includes a dithiole ring and a carbonitrile functional group. This compound typically exhibits properties associated with both sulfur-containing and nitrogen-containing heterocycles, which can influence its reactivity and stability. The presence of the amino group suggests potential for hydrogen bonding and reactivity in nucleophilic substitution reactions. The thioxo groups contribute to its electronic properties, potentially making it a candidate for various applications in organic synthesis and materials science. Additionally, the carbonitrile moiety can enhance its polarity and solubility in polar solvents. Overall, this compound may be of interest in fields such as medicinal chemistry, agrochemicals, and materials development due to its unique structural features and potential biological activity. However, specific applications and biological effects would require further investigation and research.
Formula:C4H2N2S3
InChI:InChI=1/C4H2N2S3/c5-1-2-3(6)8-9-4(2)7/h6H2
SMILES:C(#N)c1c(N)ssc1=S
Synonyms:
  • 3H-1,2-Dithiole-4-carbonitrile, 5-amino-3-thioxo-
  • 5-Amino-3-thioxo-3H-1,2-dithiole-4-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.