CAS 51471-40-0
:2-deoxy-2-{[(E)-(4-methoxyphenyl)methylidene]amino}hexopyranose
Description:
2-deoxy-2-{[(E)-(4-methoxyphenyl)methylidene]amino}hexopyranose is a synthetic carbohydrate derivative characterized by its unique structural features. This compound is a hexopyranose, indicating it has a six-membered pyranose ring structure, which is typical of many sugars. The presence of a 2-deoxy group suggests that it lacks a hydroxyl group at the second carbon, which can influence its reactivity and biological activity. The compound also contains a methoxyphenyl group, which introduces aromatic characteristics and can enhance its interaction with biological targets. The (E)-configuration of the methylidene group indicates a specific geometric arrangement that can affect the compound's stability and reactivity. Overall, this substance may exhibit interesting properties such as potential biological activity, making it a candidate for further research in medicinal chemistry or biochemistry. Its unique structure could also influence its solubility, melting point, and other physical properties, which are essential for applications in pharmaceuticals or as a biochemical probe.
Formula:C14H19NO6
InChI:InChI=1/C14H19NO6/c1-20-9-4-2-8(3-5-9)6-15-11-13(18)12(17)10(7-16)21-14(11)19/h2-6,10-14,16-19H,7H2,1H3/b15-6+
Synonyms:- hexopyranose, 2-deoxy-2-[[(1E)-(4-methoxyphenyl)methylene]amino]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-glucopyranose
CAS:2-Amino-2-deoxy-N-(4-methoxybenzylidene)-β-D-glucopyranoseColor and Shape:SolidMolecular weight:297.30g/mol2-Deoxy-2-(4-methoxybenzyliden)imino-D-glucose
CAS:2-Deoxy-2-(4-methoxybenzyliden)imino-D-glucose is a modified carbohydrate that is used for the synthesis of oligosaccharides, polysaccharides, and glycosaminoglycans. This compound is also used as a substrate for methylation reactions. It can be synthesized from D-glucose by the addition of a 2-(4-methoxybenzylidene) group to the 2′ position of the carbon atom on the anomeric carbon. The structure of this compound has been determined by X-ray crystallography.Formula:C14H19NO6Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:297.3 g/mol


