CymitQuimica logo

CAS 51471-45-5

:

N-(6-chloro-5-nitro-4-oxo-1,4-dihydropyrimidin-2-yl)acetamide

Description:
N-(6-chloro-5-nitro-4-oxo-1,4-dihydropyrimidin-2-yl)acetamide, with the CAS number 51471-45-5, is a chemical compound that belongs to the class of dihydropyrimidines, which are characterized by a six-membered ring containing nitrogen atoms. This particular compound features a chloro and a nitro group, which contribute to its reactivity and potential biological activity. The presence of the acetamide functional group suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities. The 4-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, the presence of halogen and nitro substituents often enhances the compound's lipophilicity and can affect its interaction with biological targets. Overall, N-(6-chloro-5-nitro-4-oxo-1,4-dihydropyrimidin-2-yl)acetamide is a complex molecule with potential applications in drug development and research.
Formula:C6H5ClN4O4
InChI:InChI=1/C6H5ClN4O4/c1-2(12)8-6-9-4(7)3(11(14)15)5(13)10-6/h1H3,(H2,8,9,10,12,13)
Found 0 products.