CAS 514798-21-1

5-Chloro-3-fluoro-6-iodo-2-pyridinecarboxylic acid

Description:

5-Chloro-3-fluoro-6-iodo-2-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with various halogen atoms and a carboxylic acid functional group. The compound features a chlorine atom at the 5-position, a fluorine atom at the 3-position, and an iodine atom at the 6-position of the pyridine ring, contributing to its unique reactivity and properties. The carboxylic acid group at the 2-position enhances its acidity and solubility in polar solvents. This compound is of interest in medicinal chemistry and agrochemicals due to its potential biological activity and ability to act as a building block for more complex molecules. Its halogen substitutions can influence its electronic properties, making it suitable for various applications, including as a precursor in the synthesis of pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₆H₂ClFINO₂

InChI: InChI=1S/C6H2ClFINO2/c7-2-1-3(8)4(6(11)12)10-5(2)9/h1H,(H,11,12)

InChI key: InChIKey=LLKLYYPTTLSJJF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C=C(Cl)C(I)=N1

Synonyms:

• 5-Chloro-3-fluoro-6-iodo-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-chloro-3-fluoro-6-iodo-