CAS 514801-21-9

1-(1,5-dimethyl-1H-pyrazol-4-yl)-N-methylmethanamine

Description:

1-(1,5-dimethyl-1H-pyrazol-4-yl)-N-methylmethanamine, with the CAS number 514801-21-9, is a chemical compound characterized by its unique structure that includes a pyrazole ring and a methylated amine group. This compound typically exhibits properties associated with both pyrazole derivatives and amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine functional group. The pyrazole moiety can contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical and chemical behavior. Additionally, the presence of multiple methyl groups can affect its steric properties and overall stability. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its reactivity and potential toxicity. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₇H₁₃N₃

InChI: InChI=1/C7H13N3/c1-6-7(4-8-2)5-9-10(6)3/h5,8H,4H2,1-3H3

SMILES: Cc1c(CNC)cnn1C

Synonyms:

• 1H-Pyrazole-4-methanamine, N,1,5-trimethyl-
• Methanamine, N-(1,5-dimethyl-4-pyrazolylmethyl)-
• 1-(1,5-Dimethyl-1H-pyrazol-4-yl)-N-methylmethanamine

N-[(1,5-Dimethyl-1H-pyrazol-4-yl)methyl]-N-methylamine

CAS: 514801-21-9

Formula: C₇H₁₃N₃

Molecular weight: 139.1982

Ref: IN-DA00D8LC

(1,5-Dimethyl-1 H -pyrazol-4-ylmethyl)-methyl-amine

CAS: 514801-21-9

Formula: C₇H₁₃N₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 139.202

Ref: 10-F029314