
CAS 51481-62-0
:N-[(4-Hexyl-1-piperazinyl)phenylmethylene]-2-methyl-1-propanamine
Description:
N-[(4-Hexyl-1-piperazinyl)phenylmethylene]-2-methyl-1-propanamine, with the CAS number 51481-62-0, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a hexyl substituent. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the hexyl group contributes to its hydrophobic characteristics, potentially affecting its interaction with biological membranes. Additionally, the piperazine moiety may impart pharmacological properties, making it of interest in medicinal chemistry. The compound's structure suggests potential applications in drug development, particularly in areas targeting central nervous system disorders, due to the piperazine's known activity in this field. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies. Overall, this compound represents a class of organic molecules that may have significant implications in pharmaceutical research and development.
Formula:C21H35N3
InChI:InChI=1S/C21H35N3/c1-4-5-6-10-13-23-14-16-24(17-15-23)21(22-18-19(2)3)20-11-8-7-9-12-20/h7-9,11-12,19H,4-6,10,13-18H2,1-3H3
InChI key:InChIKey=WRNQYBXJRPAGNS-UHFFFAOYSA-N
SMILES:C(=NCC(C)C)(N1CCN(CCCCCC)CC1)C2=CC=CC=C2
Synonyms:- Bucainide
- N-[(4-Hexyl-1-piperazinyl)phenylmethylene]-2-methyl-1-propanamine
- 1-Propanamine, N-[(4-hexyl-1-piperazinyl)phenylmethylene]-2-methyl-
- Piperazine, 1-hexyl-4-[[(2-methylpropyl)imino]phenylmethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bucainide
CAS:Bucainide is an agent of cardiac depressant.Formula:C21H35N3Color and Shape:SolidMolecular weight:329.52
