CAS 51482-99-6
:N-(1,1-Dimethylethyl)-β-alanine
Description:
N-(1,1-Dimethylethyl)-β-alanine, also known as tert-butyl-β-alanine, is an amino acid derivative characterized by the presence of a tert-butyl group attached to the nitrogen of the β-alanine structure. This compound features a carboxylic acid functional group (-COOH) and an amine group (-NH2), typical of amino acids, which allows it to participate in various biochemical reactions. The tert-butyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. N-(1,1-Dimethylethyl)-β-alanine is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in the context of metabolic pathways and as a building block in peptide synthesis. Its unique structure may also affect its biological activity, making it a subject of interest in research related to amino acid analogs. As with many chemical substances, safety data should be consulted for handling and usage, as it may pose certain hazards depending on concentration and exposure.
Formula:C7H15NO2
InChI:InChI=1S/C7H15NO2/c1-7(2,3)8-5-4-6(9)10/h8H,4-5H2,1-3H3,(H,9,10)
InChI key:InChIKey=GDMFYPNVLLFABQ-UHFFFAOYSA-N
SMILES:N(CCC(O)=O)C(C)(C)C
Synonyms:- β-Alanine, N-(1,1-dimethylethyl)-
- N-(1,1-Dimethylethyl)-β-alanine
- 3-tert-Butylaminopropionic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery