CAS 51484-06-1

6-bromo-4-oxo-4H-chromene-2-carboxylic acid

Description:

6-Bromo-4-oxo-4H-chromene-2-carboxylic acid is a chemical compound belonging to the class of chromenes, which are characterized by a fused benzene and pyran ring structure. This particular compound features a bromine atom at the 6-position and a carboxylic acid functional group at the 2-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the carbonyl group at the 4-position enhances its electrophilic character, making it useful in various chemical reactions, including condensation and substitution reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the bromine substituent can facilitate further functionalization, making it a versatile intermediate in synthetic chemistry. As with many organic compounds, safety precautions should be taken when handling this substance, including the use of appropriate personal protective equipment.

Formula: C₁₀H₅BrO₄

InChI: InChI=1/C10H5BrO4/c11-5-1-2-8-6(3-5)7(12)4-9(15-8)10(13)14/h1-4H,(H,13,14)

SMILES: c1cc2c(cc1Br)c(=O)cc(C(=O)O)o2

Synonyms:

• 4H-1-benzopyran-2-carboxylic acid, 6-bromo-4-oxo-
• 51484-06-1

6-Bromochromone-2-carboxylic Acid

CAS: 51484-06-1

Formula: C₁₀H₅BrO₄

Purity: >95.0%(GC)(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 269.05

Ref: 3B-B4802

6-Bromo-4-oxo-4H-chromene-2-carboxylic acid

CAS: 51484-06-1

Formula: C₁₀H₅BrO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 269.0483

Ref: IN-DA003N4N

6-Bromo-4-Oxo-4H-Chromene-2-Carboxylic Acid

CAS: 51484-06-1

6-Bromo-4-Oxo-4H-Chromene-2-Carboxylic Acid

Purity: 99%

Molecular weight: 269.05g/mol

Ref: 54-OR1030119

6-Bromochromone-2-carboxylic acid

CAS: 51484-06-1

Formula: C₁₀H₅BrO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 269.05

Ref: 10-F012036