CAS 514854-12-7
:2,4-Pyrimidinediamine, 6-ethyl-
Description:
2,4-Pyrimidinediamine, 6-ethyl- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 2 and 4 positions. The presence of two amino groups (-NH2) at the 2 and 4 positions contributes to its basicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The ethyl group at the 6 position introduces hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its molecular structure allows for potential hydrogen bonding, which can affect its physical properties, such as melting point and solubility in polar and non-polar solvents. Safety data and handling precautions should be considered, as with any chemical substance, due to potential toxicity or reactivity. Overall, 2,4-Pyrimidinediamine, 6-ethyl- is a compound with unique structural features that may have applications in medicinal chemistry and material science.
Formula:C6H10N4
InChI:InChI=1/C6H10N4/c1-2-4-3-5(7)10-6(8)9-4/h3H,2H2,1H3,(H4,7,8,9,10)
SMILES:CCc1cc(=N)[nH]c(=N)[nH]1
Synonyms:- 6-Ethyl-pyrimidine-2,4-diyldiamine
- 2,4-Pyrimidinediamine, 6-ethyl- (9CI)
- 6-Ethyl-2,4-Pyrimidinediamine
- 2,4-Diamino-6-ethylpyrimidine
- 6-Ethylpyrimidine-2,4-Diamine
- 2,4-Pyrimidinediamine, 6-ethyl- ISO 9001:2015 REACH
- 2,4-Diamino-6-ethylpyrimidine, 2,4-Diamino-6-ethyl-1,3-diazine
- 2,4-Pyrimidinediamine, 6-ethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Ethylpyrimidine-2,4-diamine (6-Ethylpyrimidine-2,4-diamine)
CAS:Compounds containing a pyrimidine ring, whether or not hydrogenated, or piperazine ring in the structure, nesoiFormula:C6H10N4Color and Shape:Off-White Fine PowderMolecular weight:138.090552,4-Pyrimidinediamine, 6-ethyl-
CAS:Formula:C6H10N4Purity:97%Color and Shape:SolidMolecular weight:138.17046-Ethylpyrimidine-2,4-diamine
CAS:6-Ethylpyrimidine-2,4-diaminePurity:97%Color and Shape:SolidMolecular weight:138.17g/mol6-Ethylpyrimidine-2,4-diamine
CAS:Formula:C6H10N4Purity:97%Color and Shape:SolidMolecular weight:138.174




