CAS 51488-33-6
:amino(3,4-dimethoxyphenyl)methaniminium chloride
Description:
Amino(3,4-dimethoxyphenyl)methaniminium chloride, with the CAS number 51488-33-6, is a chemical compound characterized by its structure, which includes an amino group, a methaniminium moiety, and a 3,4-dimethoxyphenyl group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group and the chloride ion. It may exhibit properties such as basicity due to the amino functionality, which can participate in protonation reactions. The methoxy groups on the phenyl ring can influence the compound's electronic properties, potentially affecting its reactivity and interaction with other molecules. Additionally, the presence of the chloride ion suggests that it may form salts or complexes with other substances. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex chemical entities. However, specific applications and biological effects would require further investigation and research.
Formula:C9H13ClN2O2
InChI:InChI=1/C9H12N2O2.ClH/c1-12-7-4-3-6(9(10)11)5-8(7)13-2;/h3-5H,1-2H3,(H3,10,11);1H
SMILES:COc1ccc(cc1OC)C(=N)N.Cl
Synonyms:- 3,4-Dimethoxy-Benzamidine Hcl
- 3,4-Dimethoxybenzenecarboximidamide hydrochloride (1:1)
- 3,4-Dimethoxybenzolcarboximidamidhydrochlorid(1:1)
- Benzenecarboximidamide, 3,4-Dimethoxy-, Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dimethoxy-benzamidine, HCl
CAS:Formula:C9H13ClN2O2Purity:98%Color and Shape:SolidMolecular weight:216.66473,4-Dimethoxybenzimidamide hydrochloride
CAS:3,4-Dimethoxybenzimidamide hydrochloridePurity:98%Molecular weight:216.67g/mol3,4-DIMETHOXYBENZAMIDINE HCL
CAS:Formula:C9H13ClN2O2Purity:95.0%Color and Shape:SolidMolecular weight:216.673,4-Dimethoxy-Benzamidine HCl
CAS:Please enquire for more information about 3,4-Dimethoxy-Benzamidine HCl including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H12N2O2·HClPurity:Min. 95%Molecular weight:216.66 g/mol



