CAS 515-13-9
:(-)-β-Elemene
Description:
(-)-β-Elemene is a naturally occurring sesquiterpene hydrocarbon, primarily derived from various plant sources, including certain essential oils. It is characterized by its colorless to pale yellow liquid form and has a distinctive earthy, woody aroma. The compound is known for its potential therapeutic properties, including anti-inflammatory and anticancer effects, which have garnered interest in pharmacological research. Its molecular structure features a bicyclic framework, contributing to its unique reactivity and interactions in biological systems. (-)-β-Elemene is also notable for its low solubility in water, but it is soluble in organic solvents, making it suitable for various applications in perfumery and natural product formulations. Additionally, it has been studied for its role in traditional medicine and as a potential lead compound in drug development. Safety data indicates that while it is generally regarded as safe in moderate amounts, further research is necessary to fully understand its biological effects and potential toxicity.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,13-14H,1-2,4,8-10H2,3,5-6H3/t13-,14+,15-/m1/s1
InChI key:InChIKey=OPFTUNCRGUEPRZ-QLFBSQMISA-N
SMILES:C(C)(=C)[C@H]1[C@@](C=C)(C)CC[C@@H](C(C)=C)C1
Synonyms:- (-)-β-Elemene
- (1S,2S,4R)-1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)cyclohexane
- Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, (1S,2S,4R)-
- Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-, [1S-(1α,2β,4β)]-
- Cyclohexane, 1-ethenyl-1-methyl-2,4-bis(1-methylethenyl)-,(1S-(1-alpha,2-beta,4-beta))-
- Cyclohexane, 2,4-diisopropenyl-1-methyl-1-vinyl-, (1S,2S,4R)-(-)-
- Levo-beta-elemene
- Levo-β-elemene
- β-Elemen
- beta-Elemene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
β-Elemene
CAS:β-Elemene (Levo-β-elemene) is a natural product isolated from Curcuma wenyujin, with an antitumor activity and induce cell apoptosis.Formula:C15H24Purity:99.165% - 99.35%Color and Shape:SolidMolecular weight:204.35Ref: TM-T13476
200mgTo inquire1mL*10mM (DMSO)34.00€10mg48.00€25mg78.00€50mg110.00€100mg127.00€500mg309.00€(1S,2S,4R)-1-Methyl-2,4-Di(Prop-1-En-2-Yl)-1-Vinylcyclohexane
CAS:(1S,2S,4R)-1-Methyl-2,4-Di(Prop-1-En-2-Yl)-1-VinylcyclohexanePurity:99%Molecular weight:204.35g/molβ-Elemene (10mg/ml in ethanol)
CAS:Controlled ProductFormula:C15H24Color and Shape:Single SolutionMolecular weight:204.35(-)-β-Elemene
CAS:(-)-beta-Elemene is a natural product with antifungal and anticancer properties. It has been shown to have strong in vitro activity against myeloma cell lines, HL-60 cells, and K562 cells, which are all human cancer cell lines. (-)-beta-Elemene has also been shown to be active against group P2 bacteria, including Streptococcus pneumoniae and Haemophilus influenzae. This compound has been found to inhibit the growth of solid tumours in vivo. (-)-beta-Elemene inhibits the energy metabolism of cells by altering the mitochondrial membrane potential and blocking ATP synthesis. It also induces apoptosis by regulating key cell signaling pathways, such as caspase activation and Akt/mTOR pathway inhibition.
Formula:C15H24Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:204.35 g/mol







