CAS 515-44-6

Benzenesulfonic acid, 4-hydroxy-3,5-diiodo-, sodium salt (1:1)

Description:

Benzenesulfonic acid, 4-hydroxy-3,5-diiodo-, sodium salt (1:1), commonly referred to as a sodium salt of a sulfonic acid derivative, is characterized by its aromatic structure featuring a sulfonic acid group (-SO3Na) and multiple iodine substituents on the benzene ring. This compound typically exhibits high solubility in water due to the presence of the sodium ion and the polar sulfonic acid group, making it useful in various applications, including as a reagent in organic synthesis and in dye manufacturing. The presence of hydroxyl and iodine groups contributes to its reactivity and potential biological activity. Additionally, the iodine substituents can enhance the compound's properties, such as its ability to act as a contrast agent in imaging applications. The compound is generally stable under standard conditions but may undergo degradation or reaction under extreme pH or temperature. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₄I₂O₄S·Na

InChI: InChI=1S/C6H4I2O4S.Na/c7-4-1-3(13(10,11)12)2-5(8)6(4)9;/h1-2,9H,(H,10,11,12);

InChI key: InChIKey=UXUOMAXBLMYNHI-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=CC(I)=C(O)C(I)=C1.[Na]

Synonyms:

• Benzenesulfonic acid, 4-hydroxy-3,5-diiodo-, sodium salt (1:1)
• Sozoiodole-sodium
• Sozoiodolic acid sodium salt
• Benzenesulfonic acid, 4-hydroxy-3,5-diiodo-, monosodium salt
• Sodium sozoiodolate

4-Hydroxy-3,5-diiodobenzenesufonic Acid Sodium Salt Hydrate, >95%

Controlled Product

CAS: 515-44-6

Applications A diagnostic aid.
References Hilp, M., et al.: J. Anal. Chem., 360, 184 (1998),

Formula: C₆H₃I₂NaO₄S·xH₂O

Purity: >95%

Color and Shape: Neat

Molecular weight: 447.95

Ref: TR-H941425