CAS 515-54-8
:4-Hydroxy-N-2-thiazolylbenzenesulfonamide
Description:
4-Hydroxy-N-2-thiazolylbenzenesulfonamide, with the CAS number 515-54-8, is a chemical compound that belongs to the class of sulfonamides. It features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen, and is substituted with a hydroxyl group and a sulfonamide group. This compound is typically characterized by its ability to exhibit antibacterial properties, making it of interest in medicinal chemistry. The presence of the hydroxyl group enhances its solubility in water, while the sulfonamide moiety contributes to its biological activity. Additionally, the thiazole ring can participate in various chemical reactions, allowing for potential modifications that could lead to derivatives with improved efficacy or reduced toxicity. The compound's structure suggests it may interact with biological targets, such as enzymes involved in bacterial metabolism, which is a common mechanism of action for sulfonamide antibiotics. Overall, 4-Hydroxy-N-2-thiazolylbenzenesulfonamide is a compound of interest in pharmaceutical research due to its unique structural features and potential therapeutic applications.
Formula:C9H8N2O3S2
InChI:InChI=1S/C9H8N2O3S2/c12-7-1-3-8(4-2-7)16(13,14)11-9-10-5-6-15-9/h1-6,12H,(H,10,11)
InChI key:InChIKey=JBACAGZMXLDQCR-UHFFFAOYSA-N
SMILES:S(NC1=NC=CS1)(=O)(=O)C2=CC=C(O)C=C2
Synonyms:- 4-Hydroxy-N-2-thiazolylbenzenesulfonamide
- Benzenesulfonamide, p-hydroxy-N-2-thiazolyl-
- Darvisul
- N-(2-Thiazolyl)-1-phenol-4-sulfonamide
- N-(2-Thiazolyl)-p-phenolsulfonamide
- NSC 27250
- Phenolsulfazole
- Phenolsulfon
- Phenolsulphazole
- Phenosulfazole
- Virazene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Hydroxy-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide
CAS:<p>4-Hydroxy-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide is a sulfonamide analog that has been shown to be effective for the treatment of bowel disease. The drug inhibits viral replication by interacting with the virus's RNA polymerase and blocking the formation of new viral particles. It also prevents the symptoms of radiation, dehydration, and cachexia. 4-Hydroxy-N-(1,3-thiazol-2-yl)benzene-1-sulfonamide has been found to be effective in treating inflammatory bowel disease and preventing pemphigus in animal models. This drug is also used as a preservative in some foods and detergent compositions. Although it can cause allergic reactions, there are no known side effects when taken orally.</p>Formula:C9H8N2O3S2Purity:Min. 95%Molecular weight:256.3 g/molPhenosulfazole
CAS:Phenosulfazole is a potent antiviral agent which has the potential for the research of poliomyelitis virus [1].Formula:C9H8N2O3S2Color and Shape:SolidMolecular weight:256.3

