CAS 515-82-2
:N-(2,2,2-Trichloro-1-hydroxyethyl)formamide
Description:
N-(2,2,2-Trichloro-1-hydroxyethyl)formamide, with the CAS number 515-82-2, is an organic compound characterized by its unique functional groups and chlorinated structure. It features a formamide moiety, which is indicative of its potential use in various chemical reactions and applications. The presence of three chlorine atoms on the ethyl group significantly enhances its reactivity and hydrophobic characteristics, making it a compound of interest in both industrial and laboratory settings. This chlorinated compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The compound is known for its potential applications in agrochemicals, pharmaceuticals, and as an intermediate in organic synthesis. However, due to the presence of chlorine, it may pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C3H4Cl3NO2
InChI:InChI=1S/C3H4Cl3NO2/c4-3(5,6)2(9)7-1-8/h1-2,9H,(H,7,8)
InChI key:InChIKey=ACZVWYLTJHGUCP-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(NC=O)O
Synonyms:- Chloralformamide
- Chloralamide
- N-(1-Hydroxy-2,2,2-trichloroethyl)formamide
- Formamide, N-(2,2,2-trichloro-1-hydroxyethyl)-
- N-(2,2,2-Trichloro-1-hydroxyethyl)formamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
