CAS 515-94-6
:2,3-Diaminopropionic acid
Description:
2,3-Diaminopropionic acid, with the CAS number 515-94-6, is a non-proteinogenic amino acid characterized by the presence of two amino groups (-NH2) and one carboxylic acid group (-COOH) in its structure. This compound is a derivative of propionic acid, where the amino groups are located on the second and third carbon atoms of the three-carbon chain. It is a white crystalline solid that is soluble in water, reflecting its polar nature due to the amino and carboxyl functional groups. 2,3-Diaminopropionic acid plays a role in various biochemical processes and is of interest in research related to peptide synthesis and the study of amino acid metabolism. Its unique structure allows it to participate in the formation of peptides and proteins, and it may exhibit biological activities that are being explored in pharmacological contexts. Additionally, it can serve as a building block for the synthesis of more complex molecules in organic chemistry.
Formula:C3H8N2O2
InChI:InChI=1S/C3H8N2O2/c4-1-2(5)3(6)7/h2H,1,4-5H2,(H,6,7)
InChI key:InChIKey=PECYZEOJVXMISF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(CN)N
Synonyms:- (RS)-2,3-Diaminopropionic acid
- 2,3-Diaminopropanoic acid
- 2-Amino-beta-alanine
- 2-Amino-β-alanine
- 3-Amino-<span class="text-smallcaps">DL</span>-alanine
- 3-Aminoalanine
- <span class="text-smallcaps">D</smallcap><smallcap>L</span>-2,3-Diaminopropionic acid
- <span class="text-smallcaps">DL</span>-2,3-Diaminopropanoic acid
- <span class="text-smallcaps">DL</span>-3-Aminoalanine
- <span class="text-smallcaps">DL</span>-α,β-Diaminopropionic acid
- Alanine, 3-amino-
- Diaminopropionic acid
- Propanoic acid, 2,3-diamino-
- Propionic acid, 2,3-diamino-
- beta-Aminoalanine
- α,β-Diaminopropionic acid
- β-Alanine, 2-amino-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-Diaminopropanoic acid
CAS:Formula:C3H8N2O2Purity:95%Color and Shape:SolidMolecular weight:104.10782,3-Diaminopropionicacid
CAS:<p>2,3-Diaminopropionic acid is an antimicrobial peptide with significant cytotoxicity against cancer cells. This compound has two amine groups that are able to form hydrogen bonds with each other. The x-ray crystal structures of this molecule reveal that it forms a beta sheet structure and an alpha helix, which is essential for the stability of this compound. 2,3-Diaminopropionic acid has been shown to have strong antibacterial activity against Gram-positive bacteria and good activity against Gram-negative bacteria such as Escherichia coli and Salmonella enterica. This compound also inhibits the synthesis of proteins in bacterial cells by inhibiting the enzyme protein synthesis. 2,3-Diaminopropionic acid is stable under normal conditions but can be hydrolyzed in water vapor or ester hydrochloride. It reacts with nitrogen atoms on the surface of biological molecules to form amides.</p>Formula:C3H8N2O2Purity:Min. 95%Molecular weight:104.11 g/mol2,3-Diaminopropanoic acid
CAS:Formula:C3H8N2O2Purity:≥95%Color and Shape:SolidMolecular weight:104.109



