CAS 515-96-8
:2-Amino-2-oxoacetic acid hydrazide
Description:
2-Amino-2-oxoacetic acid hydrazide, also known as hydrazinecarboxylic acid, is an organic compound characterized by the presence of both amino and hydrazide functional groups. Its molecular structure features a hydrazine moiety attached to an oxoacetic acid backbone, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which enhances its utility in biological systems. It exhibits properties such as being a potential intermediate in the synthesis of other organic compounds and may possess biological activity, making it of interest in medicinal chemistry. The presence of the amino group allows for further derivatization, while the hydrazide functionality can participate in condensation reactions. Safety data indicates that, like many hydrazine derivatives, it should be handled with care due to potential toxicity and reactivity. Overall, 2-Amino-2-oxoacetic acid hydrazide is a versatile compound with significant implications in chemical synthesis and research.
Formula:C2H5N3O2
InChI:InChI=1S/C2H5N3O2/c3-1(6)2(7)5-4/h4H2,(H2,3,6)(H,5,7)
InChI key:InChIKey=MOKRDWKSHLLYKM-UHFFFAOYSA-N
SMILES:C(C(N)=O)(NN)=O
Synonyms:- 1-(Hydrazinecarbonyl)formamide
- 2-Amino-2-oxoacetic acid hydrazide
- 2-Hydrazinyl-2-Oxoacetamide
- Acetic acid, 2-amino-2-oxo-, hydrazide
- Acetic acid, aminooxo-, hydrazide
- Aminooxamide
- Carbamoylformic acid hydrazide
- N-Aminooxamide
- NSC 45889
- Oxamic acid hydrazide
- Semioxamazid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydrazinyl-2-oxoacetamide
CAS:Formula:C2H5N3O2Purity:95%Color and Shape:SolidMolecular weight:103.0800Oxamic hydrazide
CAS:Oxamic hydrazide is an amide that consists of a nitrogen atom, an oxygen atom and two carbon atoms. It is used as a pharmaceutical preparation that has the chemical structure of p-hydroxybenzoic acid. Oxamic hydrazide is stable in the form of a complex with usnic acid. This complex has a redox potential of -0.6 volts, which is more positive than the redox potentials for many other complexes. The stability of this complex may be due to intramolecular hydrogen bonding between the hydroxyl group on one molecule and the carbonyl group on another molecule of oxamic hydrazide. Oxamic hydrazide has also been shown to form stable complexes with picolinic acid and ft-ir spectroscopy has shown that these complexes have intermolecular hydrogen bonding between their molecules.Formula:C2H5N3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:103.08 g/mol



