CymitQuimica logo

CAS 51500-32-4

:

3-Chloro-1,5-diMethyl-1H-pyrazole

Description:
3-Chloro-1,5-dimethyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two nitrogen atoms. The presence of chlorine at the 3-position and two methyl groups at the 1 and 5 positions contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in various fields, including agriculture as a pesticide or herbicide, due to its biological activity. The chlorine substituent enhances its reactivity, making it useful in synthetic organic chemistry. Additionally, 3-chloro-1,5-dimethyl-1H-pyrazole may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper storage and handling protocols are essential to ensure safety during its use in laboratory or industrial settings.
Formula:C5H7ClN2
InChI:InChI=1S/C5H7ClN2/c1-4-3-5(6)7-8(4)2/h3H,1-2H3
InChI key:ZOFUHMRPQNGBPG-UHFFFAOYSA-N
SMILES:CC1=CC(=NN1C)Cl
Synonyms:
  • 1H-Pyrazole, 3-chloro-1,5-dimethyl-
  • 3-Chloro-1,5-diMethyl-1H-pyrazole
  • EOS-60538
Found 4 products.