CAS 51501-53-2
:4,5,6-trichloropyrimidin-2-amine
Description:
4,5,6-Trichloropyrimidin-2-amine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with three chlorine atoms and an amino group. The presence of chlorine atoms at the 4, 5, and 6 positions of the pyrimidine ring significantly influences its chemical properties, including its reactivity and solubility. The amino group at the 2 position enhances its potential for hydrogen bonding and increases its polarity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. It is often used in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. Additionally, its chlorinated structure may impart unique properties that can be exploited in agrochemical applications. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4,5,6-trichloropyrimidin-2-amine serves as an important building block in organic synthesis and medicinal chemistry.
Formula:C4H2Cl3N3
InChI:InChI=1/C4H2Cl3N3/c5-1-2(6)9-4(8)10-3(1)7/h(H2,8,9,10)
SMILES:c1(c(Cl)[nH]c(=N)nc1Cl)Cl
Synonyms:- 4,5,6-trichloropyrimidin-2-amine
- 5,6-trichloropyriMidin-2-aMine
- 2-Pyrimidinamine,4,5,6-trichloro-
- trichloropyriMidin-2-aMine
- 4,5,6-trichloro-pyriMidin-2-ylaMine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,5,6-Trichloropyrimidin-2-amine
CAS:Formula:C4H2Cl3N3Purity:98%Color and Shape:SolidMolecular weight:198.43784,5,6-Trichloropyrimidin-2-amine
CAS:<p>4,5,6-Trichloropyrimidin-2-amine</p>Molecular weight:198.43778g/mol4,5,6-Trichloropyrimidin-2-amine
CAS:<p>4,5,6-Trichloropyrimidin-2-amine is a pyrimidine compound that can be synthesized from guanidine nitrate and chloroform. The reaction takes place in the presence of an organic base such as methanol or acetone. This compound has been shown to react with primary amines to form a guanidine derivative, which is then hydrolyzed to form the desired product. 4,5,6-Trichloropyrimidin-2-amine is an efficient synthesis for pyrimidine compounds because it does not require any purification steps before use.</p>Formula:C4H2Cl3N3Purity:Min. 95%Molecular weight:198.43 g/mol




