CAS 515111-36-1

[4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]-3-sulfonato-phenyl]sulfonyloxysodium

Description:

The chemical substance with the name "[4-[2-(2,4-dinitrophenyl)-3-(4-iodophenyl)tetrazol-2-ium-5-yl]-3-sulfonato-phenyl]sulfonyloxysodium" and CAS number "515111-36-1" is a complex organic compound characterized by its multi-functional groups, including a tetrazolium moiety and sulfonate groups. This compound typically exhibits high solubility in polar solvents due to the presence of ionic and polar functional groups, which enhances its reactivity and potential applications in various fields, such as analytical chemistry and biochemistry. The dinitrophenyl and iodophenyl substituents contribute to its electronic properties, making it useful in dye applications or as a reagent in chemical synthesis. Additionally, the sulfonato and sulfonyloxy groups can impart significant stability and solubility, facilitating its use in aqueous environments. Overall, this compound's unique structure and functional groups suggest potential utility in research and industrial applications, particularly in areas requiring specific reactivity or solubility characteristics.

Formula: C₁₉H₁₀IN₆NaO₁₀S₂

InChI: InChI=1/C19H11IN6O10S2.Na/c20-11-1-3-12(4-2-11)23-21-19(15-7-6-14(37(31,32)33)10-18(15)38(34,35)36)22-24(23)16-8-5-13(25(27)28)9-17(16)26(29)30;/h1-10H,(H-,31,32,33,34,35,36);/q;+1/p-1/rC19H10IN6NaO10S2/c20-11-1-3-12(4-2-11)23-21-19(15-7-6-14(39(35,36)37-27)10-18(15)38(32,33)34)22-24(23)16-8-5-13(25(28)29)9-17(16)26(30)31/h1-10H

SMILES: c1cc(ccc1I)n1nc(c2ccc(cc2S(=O)(=O)[O-])S(=O)(=O)O)n[n+]1c1ccc(cc1N(=O)=O)N(=O)=O.[Na]

4-[3-(4-Iodophenyl)-2-(2,4-Dinitrophenyl)-2H-5-Tetrazolio]-1,3-Benzene Disulfonate

CAS: 515111-36-1

Formula: C₁₉H₁₀IN₆NaO₁₀S₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 696.3411

Ref: IN-DA00DAPY

WST-3

Controlled Product

CAS: 515111-36-1

Formula: C₁₉H₁₀IN₆O₁₀S₂·Na

Color and Shape: Neat

Molecular weight: 696.34

Ref: TR-W500010

WST-3

CAS: 515111-36-1

WST-3 is a water-soluble tetrazolium dye. It is reduced by NADH in the presence of an electron mediator, such as 1-methoxy-5-methylphenazinium, to WST-3 formazan producing a dark red colour, which displays an absorption maxima of 433 nM.

Formula: C₁₉H₁₀IN₆NaO₁₀S₂

Purity: Min. 95%

Molecular weight: 696.34 g/mol

Ref: 3D-EW28732

WST-3

CAS: 515111-36-1

WST-3 is a sensitive tetrazolium reagent.

Formula: C₁₉H₁₀IN₆NaO₁₀S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 696.34

Ref: TM-T20012