CymitQuimica logo

CAS 515131-35-8

:

4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid

Description:
4-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety and a dioxaborolane group. This compound features a methyl group at the 4-position of the benzoic acid ring and a boron-containing dioxaborolane substituent that enhances its reactivity and potential applications in organic synthesis. The presence of the dioxaborolane group suggests that it may participate in various chemical reactions, such as cross-coupling reactions, making it valuable in the field of medicinal chemistry and materials science. The compound is likely to exhibit moderate solubility in organic solvents and may have specific melting and boiling points that are typical for similar organic compounds. Its unique structure may also impart specific properties, such as potential biological activity or utility in polymer chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing boron.
Formula:C14H19BO4
InChI:InChI=1/C14H19BO4/c1-9-6-7-10(12(16)17)8-11(9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17)
InChI key:SUZCHODXFJYVKA-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1B1OC(C)(C)C(C)(C)O1)C(=O)O
Synonyms:
  • T5Obotj Br B1 Evq& D1 D1 E1 E1
Found 5 products.