CymitQuimica logo

CAS 515140-26-8

:

4-(Cyclopropylaminocarbonyl)phenylboronic acid

Description:
4-(Cyclopropylaminocarbonyl)phenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a phenyl ring, which is further substituted with a cyclopropylaminocarbonyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The cyclopropyl group contributes to its unique steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the boronic acid group. Its reactivity can be attributed to the boron atom, which can participate in various chemical reactions, including Suzuki coupling and other cross-coupling reactions. Overall, this compound's structural features suggest potential utility in drug development and materials science, particularly in the design of compounds that interact with biological systems.
Formula:C10H12BNO3
InChI:InChI=1/C10H12BNO3/c13-10(12-9-5-6-9)7-1-3-8(4-2-7)11(14)15/h1-4,9,14-15H,5-6H2,(H,12,13)
InChI key:WCRPDYXXIVYAAJ-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)NC1CC1)B(O)O
Synonyms:
  • 4-(N-Cyclopropylaminocarbonyl)phenylboronic acid
  • [4-(Cyclopropylcarbamoyl)Phenyl]Boronic Acid
  • 4-Cyclopropylaminocarbonylphenylboronic Acid
Found 4 products.