CAS 515143-80-3: 3-[(3-Aminophenyl)methyl]-2,4-imidazolidinedione

Description: 3-[(3-Aminophenyl)methyl]-2,4-imidazolidinedione, identified by its CAS number 515143-80-3, is a chemical compound characterized by its imidazolidinedione core structure, which features two carbonyl groups adjacent to a nitrogen atom in a five-membered ring. This compound typically exhibits properties associated with both amines and diketones, making it potentially useful in various chemical reactions and applications. The presence of the 3-aminophenyl group suggests that it may have biological activity, possibly acting as a ligand or a precursor in pharmaceutical synthesis. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, allowing for further derivatization or interaction with other chemical entities. Overall, 3-[(3-Aminophenyl)methyl]-2,4-imidazolidinedione represents a versatile structure in organic chemistry, with potential implications in medicinal chemistry and material science.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c11-8-3-1-2-7(4-8)6-13-9(14)5-12-10(13)15/h1-4H,5-6,11H2,(H,12,15)

InChI key: InChIKey=ODNCNVHRERQZOX-UHFFFAOYSA-N

SMILES: O=C1NCC(=O)N1CC=2C=CC=C(N)C2

Synonyms:

• 2,4-Imidazolidinedione, 3-[(3-aminophenyl)methyl]-
• 3-(2,5-Dioxoimidazolidin-1-ylmethyl)aniline
• 3-[(3-Aminophenyl)methyl]-2,4-imidazolidinedione

3-[(3-Aminophenyl)methyl]imidazolidine-2,4-dione

CAS: 515143-80-3

Versatile small molecule scaffold

• Formula: C₁₀H₁₁N₃O₂
• Purity: Min. 95%
• Molecular weight: 205.21 g/mol

3-[(3-aminophenyl)methyl]imidazolidine-2,4-dione

CAS: 515143-80-3

• Purity: 95%
• Molecular weight: 205.2169952392578