CymitQuimica logo

CAS 51528-59-7

:

Phosphoglycolohydroxamic acid

Description:
Phosphoglycolohydroxamic acid is a chemical compound characterized by its unique structure, which includes a hydroxamic acid functional group and a phosphonic acid moiety. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in various chemical applications. It is known for its role as a chelating agent, particularly in the context of metal ion binding, which can be beneficial in agricultural and pharmaceutical applications. The presence of both hydroxamic and phosphonic functionalities allows it to interact with biological systems, potentially influencing enzyme activity and metabolic pathways. Additionally, phosphoglycolohydroxamic acid may exhibit properties such as antimicrobial activity or serve as a precursor in the synthesis of more complex molecules. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use.
Formula:C2H6NO6P
InChI:InChI=1S/C2H6NO6P/c4-2(3-5)1-9-10(6,7)8/h5H,1H2,(H,3,4)(H2,6,7,8)
InChI key:InChIKey=BAXHHWZKQZIJID-UHFFFAOYSA-N
SMILES:C(C(NO)=O)OP(=O)(O)O
Synonyms:
  • 2-Phosphoglycolohydroxamic acid
  • Phosphoglycolohydroxamic acid
  • N-Hydroxy-2-(phosphonooxy)acetamide
  • Acetamide, N-hydroxy-2-(phosphonooxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.