CAS 5153-40-2: 1-Bromo-2,3,4,5,6-pentamethylbenzene
Description:1-Bromo-2,3,4,5,6-pentamethylbenzene, with the CAS number 5153-40-2, is an aromatic compound characterized by a bromine atom substituted on a benzene ring that is further substituted with five methyl groups. This compound belongs to the class of brominated aromatic hydrocarbons, which are known for their diverse applications in organic synthesis and materials science. The presence of multiple methyl groups enhances the hydrophobic character of the molecule and influences its physical properties, such as boiling and melting points, making it less volatile compared to simpler aromatic compounds. The bromine substituent can participate in various chemical reactions, including nucleophilic substitution and cross-coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the steric hindrance introduced by the methyl groups can affect the reactivity and stability of the compound. Overall, 1-Bromo-2,3,4,5,6-pentamethylbenzene is a significant compound in the field of organic chemistry, particularly in the development of complex organic molecules.
Formula:C11H15Br
InChI:InChI=1S/C11H15Br/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3
InChI key:InChIKey=XPDQRULPGCFCLX-UHFFFAOYSA-N
SMILES:BrC=1C(=C(C(=C(C1C)C)C)C)C
- Synonyms:
- 1-Bromo-2,3,4,5,6-Pentamethylbenzene
- 2,3,4,5,6-Pentamethylbromobenzene
- Benzene, 1-bromo-2,3,4,5,6-pentamethyl-
- Benzene, bromopentamethyl-
- NSC 340
- Pentamethylbromobenzene
- Bromopentamethylbenzene
