CAS 5153-57-1

N6,N6,2-Trimethyl-3,6-acridinediamine

Description:

N6,N6,2-Trimethyl-3,6-acridinediamine, with the CAS number 5153-57-1, is an organic compound characterized by its acridine structure, which consists of a fused ring system that includes nitrogen atoms. This compound features two amino groups (–NH2) at the 3 and 6 positions of the acridine ring, and three methyl groups (–CH3) attached to the nitrogen at the 6 position. The presence of these functional groups contributes to its potential as a dye intermediate or in various chemical syntheses. The trimethyl substitution enhances its solubility and reactivity, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit specific optical and electronic properties due to its aromatic structure, which can be leveraged in materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₆H₁₇N₃

InChI: InChI=1S/C16H17N3/c1-10-6-12-7-11-4-5-13(19(2)3)8-15(11)18-16(12)9-14(10)17/h4-9H,17H2,1-3H3

InChI key: InChIKey=NQRLWRODNCDUHY-UHFFFAOYSA-N

SMILES: N(C)(C)C1=CC2=C(C=C3C(=N2)C=C(N)C(C)=C3)C=C1

Synonyms:

• N6,N6,2-Trimethyl-3,6-acridinediamine
• 3,6-Acridinediamine, N6,N6,2-trimethyl-
• Acridine, 3-amino-6-(dimethylamino)-2-methyl-

Coriphosphine

CAS: 5153-57-1

Coriphosphine is a bioactive chemical.

Formula: C₁₆H₁₇N₃

Color and Shape: Solid

Molecular weight: 251.333

Ref: TM-T31012