CAS 5153-71-9
:trans-4-Bromo-β-nitrostyrene
Description:
Trans-4-Bromo-β-nitrostyrene is an organic compound characterized by its unique structure, which includes a bromine atom and a nitro group attached to a styrene backbone. This compound typically appears as a yellow to orange solid and is known for its reactivity due to the presence of both the bromine and nitro functional groups, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The trans configuration indicates that the bromine and nitro groups are positioned on opposite sides of the double bond in the styrene moiety, influencing its physical and chemical properties. Trans-4-Bromo-β-nitrostyrene is often utilized in organic synthesis and can serve as an intermediate in the production of more complex molecules. Its properties, such as solubility and melting point, can vary based on the solvent and conditions used. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H6BrNO2
InChI:InChI=1S/C8H6BrNO2/c9-8-3-1-7(2-4-8)5-6-10(11)12/h1-6H/b6-5+
InChI key:InChIKey=LSGVHLGCJIBLMB-AATRIKPKSA-N
SMILES:C(=C/N(=O)=O)\C1=CC=C(Br)C=C1
Synonyms:- (E)-1-(4-Bromophenyl)-2-nitroethene
- (E)-1-Bromo-4-(2-nitroethenyl)benzene
- (E)-2-(4-Bromophenyl)-1-nitroethene
- (E)-4-Bromo-(2-nitrovinyl)benzene
- (E)-β-Nitro-4-bromostyrene
- 1-Bromo-4-[(1E)-2-nitroethenyl]benzene
- 1-bromo-4-[(E)-2-nitroethenyl]benzene
- Benzene, 1-bromo-4-(2-nitroethenyl)-, (E)-
- Benzene, 1-bromo-4-[(1E)-2-nitroethenyl]-
- E-4-Bromo-β-nitrostyrene
- Styrene, p-bromo-β-nitro-, (E)-
- trans-4-Bromo-β-nitrostyrene
- trans-p-Bromo-β-nitrostyrene
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-4-Bromo-β-nitrostyrene
CAS:Formula:C8H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:228.0427(E)-1-Bromo-4-(2-nitrovinyl)benzene
CAS:(E)-1-Bromo-4-(2-nitrovinyl)benzenePurity:99%Molecular weight:228.05g/mol(E)-1-Bromo-4-(2-nitrovinyl)benzene
CAS:Formula:C8H6BrNO2Purity:97%Color and Shape:SolidMolecular weight:228.045trans-4-Bromo-b-nitrostyrene
CAS:Trans-4-bromo-b-nitrostyrene is a synthetic intermediate that can be used for the synthesis of polymers, pharmaceuticals, and dyes. It has been shown to react with organocatalysts to form new carbon-carbon bonds. Trans-4-bromo-b-nitrostyrene reacts with a chiral catalyst in an enamine reaction to produce a mixture of two diastereomers. The conformation of trans-4-bromo-b-nitrostyrene was optimized by using the dihedral angles and carbonyl groups within the molecule. Trans-4-(bromomethyl)styrene is used in the synthesis of certain biomolecules such as proteins, antibiotics, and nucleic acids.
Formula:C8H6BrNO2Purity:Min. 95%Color and Shape:SolidMolecular weight:228.04 g/mol



