CymitQuimica logo

CAS 5154-00-7

:

2-Amino-6-hydroxypyridine

Description:
2-Amino-6-hydroxypyridine, with the CAS number 5154-00-7, is an organic compound characterized by its pyridine ring structure, which features both an amino group (-NH2) and a hydroxyl group (-OH) at the 2 and 6 positions, respectively. This compound is typically a white to light yellow crystalline solid and is soluble in water due to the presence of polar functional groups. It exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. 2-Amino-6-hydroxypyridine is of interest in medicinal chemistry and materials science, as it may serve as a building block for the synthesis of pharmaceuticals and agrochemicals. Additionally, its derivatives can exhibit biological activity, making it a subject of research in various fields, including biochemistry and pharmacology.
Formula:C5H6N2O
InChI:InChI=1S/C5H6N2O/c6-4-2-1-3-5(8)7-4/h1-3H,(H3,6,7,8)
InChI key:DMIHQARPYPNHJD-UHFFFAOYSA-N
SMILES:C1=CC(=O)NC(=C1)N
Synonyms:
  • 6-Amino-2-Hydroxypyridine
Found 5 products.