CAS 5154-41-6
:1-(4-chlorophenyl)-3-(1-methylpropyl)urea
Description:
1-(4-chlorophenyl)-3-(1-methylpropyl)urea, also known by its CAS number 5154-41-6, is an organic compound that belongs to the class of ureas. This substance features a urea functional group, characterized by the presence of a carbonyl group (C=O) bonded to two amine groups (NH2). The molecule contains a 4-chlorophenyl group, which contributes to its aromatic properties and potential biological activity, as well as a branched alkyl substituent (1-methylpropyl) that influences its solubility and steric properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their hydrophobic aromatic and aliphatic components. The presence of the chlorine atom can enhance the compound's reactivity and biological interactions. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in herbicides or as a growth regulator. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental conditions and the presence of other chemical species.
Formula:C11H15ClN2O
InChI:InChI=1/C11H15ClN2O/c1-3-8(2)13-11(15)14-10-6-4-9(12)5-7-10/h4-8H,3H2,1-2H3,(H2,13,14,15)
Synonyms:- 1-sec-Butyl-3-(4-chlorophenyl)urea
- urea, N-(4-chlorophenyl)-N'-(1-methylpropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Luteolin 3'-glucoside
CAS:Natural glycosideFormula:C21H20O11Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:448.381-Butan-2-yl-3-(4-chlorophenyl)urea
CAS:1-Butan-2-yl-3-(4-chlorophenyl)urea is a synthetic compound, which is derived from chemical synthesis involving chlorinated aromatic amines and isocyanates. This compound is characterized by its unique molecular structure that combines a chlorinated phenyl ring with a urea moiety, providing specific physicochemical properties that are of interest in various biochemical assays.
Formula:C11H15ClN2OPurity:Min. 95%Molecular weight:226.7 g/molRef: 3D-FAA15441
Discontinued product

