CAS 5155-47-5
:(3R,5S,6R)-2-(aminomethyl)-6-methoxy-tetrahydropyran-3,4,5-triol
Description:
The chemical substance known as "(3R,5S,6R)-2-(aminomethyl)-6-methoxy-tetrahydropyran-3,4,5-triol," with the CAS number 5155-47-5, is a carbohydrate derivative characterized by a tetrahydropyran ring structure. This compound features multiple hydroxyl (-OH) groups, which contribute to its hydrophilicity and potential for forming hydrogen bonds, enhancing its solubility in polar solvents. The presence of an aminomethyl group indicates that it may participate in various chemical reactions, including those involving amine functionalities. The methoxy group (-OCH3) adds to the compound's complexity and can influence its reactivity and interaction with biological systems. The specific stereochemistry, denoted by the (3R,5S,6R) configuration, suggests that the compound may exhibit unique biological activities or properties, making it of interest in medicinal chemistry and pharmaceutical applications. Overall, this compound's structural features suggest potential utility in various fields, including drug development and synthetic chemistry.
Formula:C7H15NO5
InChI:InChI=1/C7H15NO5/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-7,9-11H,2,8H2,1H3/t3?,4-,5?,6-,7+/m0/s1
Synonyms:- Methyl 6-amino-6-deoxy-D-gulopyranoside
- Methyl 6-amino-deoxy-galactoyranosideMethyl 6-Amino-6-Deoxy-Galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 6-amino-6-deoxy-a-D-glucopyranoside
CAS:<p>Methyl 6-amino-6-deoxy-a-D-glucopyranoside</p>Formula:C7H15NO5Purity:By hplc: 98.2% (Typical Value in Batch COA)Color and Shape: off-white to yellow syrup/ oilMolecular weight:193.20g/molMethyl 6-amino-6-deoxy-a-D-glucopyranoside
CAS:Formula:C7H15NO5Purity:≥ 98.0%Color and Shape:Off-white to yellow viscous liquid or solidMolecular weight:193.20Methyl 6-amino-6-deoxy-a-D-glucopyranoside
CAS:Methyl 6-amino-6-deoxy-a-D-glucopyranoside is a saccharide with a molecular weight of 362.4 g/mol. This carbohydrate is fluorinated and modified with an amine group on the C1 position, which makes it a complex carbohydrate. It can be custom synthesized to order and has high purity. CAS No. 5155-47-5Formula:C7H15NO5Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:193.2 g/mol(2R,3S,4S,5R,6S)-2-(aminomethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triol
CAS:Formula:C7H15NO5Purity:95.0%Color and Shape:No data available.Molecular weight:193.199Methyl 6-Amino-6-deoxy-α-D-glucopyranoside
CAS:Controlled ProductFormula:C7H15NO5Color and Shape:NeatMolecular weight:193.198




